C22H36O4 — CID 162850902
[2-(1,2-dihydroxyethyl)-2,4a,8,8-tetramethyl-3,4,6,7,8a,9,10,10a-octahydro-1H-phenanthren-4-yl] acetate (PubChem CID 162850902) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is [2-(1,2-dihydroxyethyl)-2,4a,8,8-tetramethyl-3,4,6,7,8a,9,10,10a-octahydro-1H-phenanthren-4-yl] acetate.
| Compound Name | [2-(1,2-dihydroxyethyl)-2,4a,8,8-tetramethyl-3,4,6,7,8a,9,10,10a-octahydro-1H-phenanthren-4-yl] acetate |
|---|---|
| PubChem CID | 162850902 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [2-(1,2-dihydroxyethyl)-2,4a,8,8-tetramethyl-3,4,6,7,8a,9,10,10a-octahydro-1H-phenanthren-4-yl] acetate |
| SMILES | CC(=O)OC1CC(C)(C(O)CO)CC2CCC3C(=CCCC3(C)C)C21C |
| InChI | InChI=1S/C22H36O4/c1-14(24)26-19-12-21(4,18(25)13-23)11-15-8-9-16-17(22(15,19)5)7-6-10-20(16,2)3/h7,15-16,18-19,23,25H,6,8-13H2,1-5H3 |
| InChIKey | NTEYEQYDRUGUKN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|