C34H56O5 — CID 541267
[17-(5-acetyloxy-6-methylheptan-2-yl)-11-hydroxy-4,4,10,13,14-pentamethyl-2,3,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 541267) has the molecular formula C34H56O5 and a molecular weight of 544.82 g/mol. Its IUPAC name is [17-(5-acetyloxy-6-methylheptan-2-yl)-11-hydroxy-4,4,10,13,14-pentamethyl-2,3,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-(5-acetyloxy-6-methylheptan-2-yl)-11-hydroxy-4,4,10,13,14-pentamethyl-2,3,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 541267 |
| Molecular Formula | C34H56O5 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.41 |
| IUPAC Name | [17-(5-acetyloxy-6-methylheptan-2-yl)-11-hydroxy-4,4,10,13,14-pentamethyl-2,3,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC(CCC(C)C1CCC2(C)C3CC=C4C(C)(C)C(OC(C)=O)CCC4(C)C3C(O)CC12C)C(C)C |
| InChI | InChI=1S/C34H56O5/c1-20(2)27(38-22(4)35)13-11-21(3)24-15-18-33(9)25-12-14-28-31(6,7)29(39-23(5)36)16-17-32(28,8)30(25)26(37)19-34(24,33)10/h14,20-21,24-27,29-30,37H,11-13,15-19H2,1-10H3 |
| InChIKey | DVJUXZSVJHKWSR-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|