C34H54O5 — CID 169089015
[(3S,5R,10S,13R,14S,17R)-17-[(2R)-6-acetyloxyoctan-2-yl]-4,4,10,13,14-pentamethyl-7-oxo-1,2,3,5,6,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 169089015) has the molecular formula C34H54O5 and a molecular weight of 542.80 g/mol. Its IUPAC name is [(3S,5R,10S,13R,14S,17R)-17-[(2R)-6-acetyloxyoctan-2-yl]-4,4,10,13,14-pentamethyl-7-oxo-1,2,3,5,6,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5R,10S,13R,14S,17R)-17-[(2R)-6-acetyloxyoctan-2-yl]-4,4,10,13,14-pentamethyl-7-oxo-1,2,3,5,6,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 169089015 |
| Molecular Formula | C34H54O5 |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.40 |
| IUPAC Name | [(3S,5R,10S,13R,14S,17R)-17-[(2R)-6-acetyloxyoctan-2-yl]-4,4,10,13,14-pentamethyl-7-oxo-1,2,3,5,6,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCC(CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3C(=O)C[C@H]4C(C)(C)[C@@H](OC(C)=O)CC[C@]4(C)C3=CC[C@]12C)OC(C)=O |
| InChI | InChI=1S/C34H54O5/c1-10-24(38-22(3)35)13-11-12-21(2)25-14-19-34(9)30-26(15-18-33(25,34)8)32(7)17-16-29(39-23(4)36)31(5,6)28(32)20-27(30)37/h15,21,24-25,28-30H,10-14,16-20H2,1-9H3/t21-,24?,25-,28+,29+,30?,32-,33-,34+/m1/s1 |
| InChIKey | MBRZGUNIUXMGOW-OQWZFHNESA-N |
| XLogP | 7.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|