C33H54O3 — CID 75306405
[17-(5-hydroxy-5,6-dimethylhept-6-en-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 75306405) has the molecular formula C33H54O3 and a molecular weight of 498.79 g/mol. Its IUPAC name is [17-(5-hydroxy-5,6-dimethylhept-6-en-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-(5-hydroxy-5,6-dimethylhept-6-en-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 75306405 |
| Molecular Formula | C33H54O3 |
| Molecular Weight | 498.79 g/mol |
| Exact Mass | 498.41 |
| IUPAC Name | [17-(5-hydroxy-5,6-dimethylhept-6-en-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | C=C(C)C(C)(O)CCC(C)C1CCC2(C)C3CCC4C(C)(CCC(OC(C)=O)C4(C)C)C3=CCC12C |
| InChI | InChI=1S/C33H54O3/c1-21(2)33(10,35)20-13-22(3)24-14-18-32(9)26-11-12-27-29(5,6)28(36-23(4)34)16-17-30(27,7)25(26)15-19-31(24,32)8/h15,22,24,26-28,35H,1,11-14,16-20H2,2-10H3 |
| InChIKey | RWZJLQNNTUIDOA-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.79 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|