C32H52O4 — CID 171123542
[(3S,5S,10S,13R,14R,17S)-17-[(3R,6R)-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 171123542) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is [(3S,5S,10S,13R,14R,17S)-17-[(3R,6R)-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,10S,13R,14R,17S)-17-[(3R,6R)-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 171123542 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | [(3S,5S,10S,13R,14R,17S)-17-[(3R,6R)-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)C3=CC[C@]4(C)[C@H]([C@H]5CC[C@H](C(C)(C)O)OC5)CC[C@]4(C)C3CC[C@@H]2C1(C)C |
| InChI | InChI=1S/C32H52O4/c1-20(33)36-26-15-16-30(6)23-14-18-31(7)22(21-9-12-27(35-19-21)29(4,5)34)13-17-32(31,8)24(23)10-11-25(30)28(26,2)3/h14,21-22,24-27,34H,9-13,15-19H2,1-8H3/t21-,22-,24?,25+,26-,27+,30+,31+,32+/m0/s1 |
| InChIKey | RQOLABRIEANNOS-YCXBMUHESA-N |
| XLogP | 7.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|