C30H50O5 — CID 139587534
(2R,3R,5R,8S,10S,13R,14S,17R)-17-[(2S,6R)-2-hydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3-diol (PubChem CID 139587534) has the molecular formula C30H50O5 and a molecular weight of 490.73 g/mol. Its IUPAC name is (2R,3R,5R,8S,10S,13R,14S,17R)-17-[(2S,6R)-2-hydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3-diol.
| Compound Name | (2R,3R,5R,8S,10S,13R,14S,17R)-17-[(2S,6R)-2-hydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 139587534 |
| Molecular Formula | C30H50O5 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | (2R,3R,5R,8S,10S,13R,14S,17R)-17-[(2S,6R)-2-hydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3-diol |
| SMILES | CC(C)(O)[C@H]1CCC([C@H]2CC[C@@]3(C)[C@@H]4CC[C@H]5C(C)(C)[C@@H](O)[C@H](O)C[C@]5(C)C4=CC[C@]23C)[C@@H](O)O1 |
| InChI | InChI=1S/C30H50O5/c1-26(2)22-10-9-20-19(28(22,5)16-21(31)24(26)32)13-15-29(6)18(12-14-30(20,29)7)17-8-11-23(27(3,4)34)35-25(17)33/h13,17-18,20-25,31-34H,8-12,14-16H2,1-7H3/t17?,18-,20-,21-,22+,23-,24+,25+,28-,29-,30+/m1/s1 |
| InChIKey | ZCGUUZJOOPGTNS-FDLCNJDLSA-N |
| XLogP | 4.81 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|