C30H50O2 — CID 162906198
3a-(hydroxymethyl)-5a,8,8,11a,13a-pentamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,7a,9,10,11,13,13b-tetradecahydrocyclopenta[a]chrysen-9-ol (PubChem CID 162906198) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 3a-(hydroxymethyl)-5a,8,8,11a,13a-pentamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,7a,9,10,11,13,13b-tetradecahydrocyclopenta[a]chrysen-9-ol.
| Compound Name | 3a-(hydroxymethyl)-5a,8,8,11a,13a-pentamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,7a,9,10,11,13,13b-tetradecahydrocyclopenta[a]chrysen-9-ol |
|---|---|
| PubChem CID | 162906198 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | 3a-(hydroxymethyl)-5a,8,8,11a,13a-pentamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,7a,9,10,11,13,13b-tetradecahydrocyclopenta[a]chrysen-9-ol |
| SMILES | CC(C)C1CCC2C1(CO)CCC1(C)C3CCC4C(C)(CCC(O)C4(C)C)C3=CCC21C |
| InChI | InChI=1S/C30H50O2/c1-19(2)20-8-11-24-29(7)15-12-21-22(28(29,6)16-17-30(20,24)18-31)9-10-23-26(3,4)25(32)13-14-27(21,23)5/h12,19-20,22-25,31-32H,8-11,13-18H2,1-7H3 |
| InChIKey | MXURHXOXOVAUDO-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|