C30H50O — CID 162880653
(3R,3aR,5aR,5bS,6R,7aR,11aS,13aS,13bR)-3a,5a,8,8,11a,13a-hexamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,7a,9,10,11,13,13b-tetradecahydrocyclopenta[a]chrysen-6-ol (PubChem CID 162880653) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is (3R,3aR,5aR,5bS,6R,7aR,11aS,13aS,13bR)-3a,5a,8,8,11a,13a-hexamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,7a,9,10,11,13,13b-tetradecahydrocyclopenta[a]chrysen-6-ol.
| Compound Name | (3R,3aR,5aR,5bS,6R,7aR,11aS,13aS,13bR)-3a,5a,8,8,11a,13a-hexamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,7a,9,10,11,13,13b-tetradecahydrocyclopenta[a]chrysen-6-ol |
|---|---|
| PubChem CID | 162880653 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | (3R,3aR,5aR,5bS,6R,7aR,11aS,13aS,13bR)-3a,5a,8,8,11a,13a-hexamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,7a,9,10,11,13,13b-tetradecahydrocyclopenta[a]chrysen-6-ol |
| SMILES | CC(C)[C@H]1CC[C@@H]2[C@]1(C)CC[C@]1(C)[C@H]3C(=CC[C@@]21C)[C@@]1(C)CCCC(C)(C)[C@H]1C[C@H]3O |
| InChI | InChI=1S/C30H50O/c1-19(2)20-10-11-23-28(20,6)16-17-30(8)25-21(12-15-29(23,30)7)27(5)14-9-13-26(3,4)24(27)18-22(25)31/h12,19-20,22-25,31H,9-11,13-18H2,1-8H3/t20-,22-,23-,24-,25+,27-,28-,29+,30-/m1/s1 |
| InChIKey | OBNZRBHOWIFSNY-CUIKMKIVSA-N |
| XLogP | 8.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|