C30H46O4 — CID 146682870
(1R,5R,6S,7R,9S,10S,13S,14S,15S,17S,19S)-7,19-dihydroxy-5,10,13,18,18-pentamethyl-9-propan-2-yl-23-oxahexacyclo[13.6.2.01,17.02,14.05,13.06,10]tricos-2-en-22-one (PubChem CID 146682870) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is (1R,5R,6S,7R,9S,10S,13S,14S,15S,17S,19S)-7,19-dihydroxy-5,10,13,18,18-pentamethyl-9-propan-2-yl-23-oxahexacyclo[13.6.2.01,17.02,14.05,13.06,10]tricos-2-en-22-one.
| Compound Name | (1R,5R,6S,7R,9S,10S,13S,14S,15S,17S,19S)-7,19-dihydroxy-5,10,13,18,18-pentamethyl-9-propan-2-yl-23-oxahexacyclo[13.6.2.01,17.02,14.05,13.06,10]tricos-2-en-22-one |
|---|---|
| PubChem CID | 146682870 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (1R,5R,6S,7R,9S,10S,13S,14S,15S,17S,19S)-7,19-dihydroxy-5,10,13,18,18-pentamethyl-9-propan-2-yl-23-oxahexacyclo[13.6.2.01,17.02,14.05,13.06,10]tricos-2-en-22-one |
| SMILES | CC(C)[C@@H]1C[C@@H](O)[C@H]2[C@@]1(C)CC[C@@]1(C)[C@H]3C(=CC[C@]21C)[C@@]12CC[C@H](O)C(C)(C)[C@@H]1C[C@@H]3OC2=O |
| InChI | InChI=1S/C30H46O4/c1-16(2)18-14-19(31)24-27(18,5)12-13-28(6)23-17(8-10-29(24,28)7)30-11-9-22(32)26(3,4)21(30)15-20(23)34-25(30)33/h8,16,18-24,31-32H,9-15H2,1-7H3/t18-,19+,20-,21-,22-,23-,24-,27-,28-,29+,30-/m0/s1 |
| InChIKey | XTDZPDYSGQYQSB-ALVNHYKLSA-N |
| XLogP | 5.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|