C30H48O — CID 162891199
(3R,3aS,5aR,5bR,7aS,11aS,13aS,13bR)-3a,5a,8,8,11a,13a-hexamethyl-3-propan-2-yl-3,4,5,5b,6,7,7a,9,10,11,13,13b-dodecahydro-1H-cyclopenta[a]chrysen-2-one (PubChem CID 162891199) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is (3R,3aS,5aR,5bR,7aS,11aS,13aS,13bR)-3a,5a,8,8,11a,13a-hexamethyl-3-propan-2-yl-3,4,5,5b,6,7,7a,9,10,11,13,13b-dodecahydro-1H-cyclopenta[a]chrysen-2-one.
| Compound Name | (3R,3aS,5aR,5bR,7aS,11aS,13aS,13bR)-3a,5a,8,8,11a,13a-hexamethyl-3-propan-2-yl-3,4,5,5b,6,7,7a,9,10,11,13,13b-dodecahydro-1H-cyclopenta[a]chrysen-2-one |
|---|---|
| PubChem CID | 162891199 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | (3R,3aS,5aR,5bR,7aS,11aS,13aS,13bR)-3a,5a,8,8,11a,13a-hexamethyl-3-propan-2-yl-3,4,5,5b,6,7,7a,9,10,11,13,13b-dodecahydro-1H-cyclopenta[a]chrysen-2-one |
| SMILES | CC(C)[C@H]1C(=O)C[C@@H]2[C@]1(C)CC[C@]1(C)[C@H]3CC[C@H]4C(C)(C)CCC[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C30H48O/c1-19(2)25-22(31)18-24-28(25,6)16-17-29(7)21-10-11-23-26(3,4)13-9-14-27(23,5)20(21)12-15-30(24,29)8/h12,19,21,23-25H,9-11,13-18H2,1-8H3/t21-,23-,24+,25-,27+,28-,29+,30-/m0/s1 |
| InChIKey | GOOGDVBOYLWGDB-FUTKGYOTSA-N |
| XLogP | 8.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|