C31H50O3 — CID 163041010
3-hydroxy-4,4,10,13,14-pentamethyl-17-(6-methyl-6-propan-2-yloxan-3-yl)-1,3,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-2-one (PubChem CID 163041010) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is 3-hydroxy-4,4,10,13,14-pentamethyl-17-(6-methyl-6-propan-2-yloxan-3-yl)-1,3,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-2-one.
| Compound Name | 3-hydroxy-4,4,10,13,14-pentamethyl-17-(6-methyl-6-propan-2-yloxan-3-yl)-1,3,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-2-one |
|---|---|
| PubChem CID | 163041010 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | 3-hydroxy-4,4,10,13,14-pentamethyl-17-(6-methyl-6-propan-2-yloxan-3-yl)-1,3,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-2-one |
| SMILES | CC(C)C1(C)CCC(C2CCC3(C)C4CCC5C(C)(CC(=O)C(O)C5(C)C)C4=CCC23C)CO1 |
| InChI | InChI=1S/C31H50O3/c1-19(2)31(8)16-11-20(18-34-31)21-12-14-30(7)23-9-10-25-27(3,4)26(33)24(32)17-28(25,5)22(23)13-15-29(21,30)6/h13,19-21,23,25-26,33H,9-12,14-18H2,1-8H3 |
| InChIKey | NKEFZISGPJXYPB-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|