C32H52O3 — CID 635503
[2,6,6,11,15-pentamethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-5-yl] acetate (PubChem CID 635503) has the molecular formula C32H52O3 and a molecular weight of 484.77 g/mol. Its IUPAC name is [2,6,6,11,15-pentamethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-5-yl] acetate.
| Compound Name | [2,6,6,11,15-pentamethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-5-yl] acetate |
|---|---|
| PubChem CID | 635503 |
| Molecular Formula | C32H52O3 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.39 |
| IUPAC Name | [2,6,6,11,15-pentamethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-5-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CC=C3C4(C)CCC(C(C)CCCC(C)C)C4(C)CC4OC342)C1(C)C |
| InChI | InChI=1S/C32H52O3/c1-20(2)11-10-12-21(3)23-15-17-29(7)25-14-13-24-28(5,6)26(34-22(4)33)16-18-30(24,8)32(25)27(35-32)19-31(23,29)9/h14,20-21,23-24,26-27H,10-13,15-19H2,1-9H3 |
| InChIKey | WBVPTPVVVFOMLB-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|