C34H56O5 — CID 102167095
[(1S,2S,5S,7S,9S,10R,11S,14R,15R,17S)-9-acetyloxy-2,6,6,11,15-pentamethyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-5-yl] acetate (PubChem CID 102167095) has the molecular formula C34H56O5 and a molecular weight of 544.82 g/mol. Its IUPAC name is [(1S,2S,5S,7S,9S,10R,11S,14R,15R,17S)-9-acetyloxy-2,6,6,11,15-pentamethyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-5-yl] acetate.
| Compound Name | [(1S,2S,5S,7S,9S,10R,11S,14R,15R,17S)-9-acetyloxy-2,6,6,11,15-pentamethyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 102167095 |
| Molecular Formula | C34H56O5 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.41 |
| IUPAC Name | [(1S,2S,5S,7S,9S,10R,11S,14R,15R,17S)-9-acetyloxy-2,6,6,11,15-pentamethyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2C(C)(C)[C@@H](OC(C)=O)CC[C@]2(C)[C@]23O[C@H]2C[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@]2(C)[C@H]13 |
| InChI | InChI=1S/C34H56O5/c1-20(2)12-11-13-21(3)24-14-16-32(9)29-25(37-22(4)35)18-26-30(6,7)27(38-23(5)36)15-17-31(26,8)34(29)28(39-34)19-33(24,32)10/h20-21,24-29H,11-19H2,1-10H3/t21-,24-,25+,26+,27+,28+,29+,31+,32+,33-,34+/m1/s1 |
| InChIKey | CKNHYKDMXSUFFN-ZIYNDZGESA-N |
| XLogP | 7.74 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|