C32H52Br2O3 — CID 4868298
[9,17-dibromo-2,6,6,11,15-pentamethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-yl] acetate (PubChem CID 4868298) has the molecular formula C32H52Br2O3 and a molecular weight of 644.57 g/mol. Its IUPAC name is [9,17-dibromo-2,6,6,11,15-pentamethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-yl] acetate.
| Compound Name | [9,17-dibromo-2,6,6,11,15-pentamethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 4868298 |
| Molecular Formula | C32H52Br2O3 |
| Molecular Weight | 644.57 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | [9,17-dibromo-2,6,6,11,15-pentamethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CC(Br)C34OC23C(Br)CC2(C)C(C(C)CCCC(C)C)CCC24C)C1(C)C |
| InChI | InChI=1S/C32H52Br2O3/c1-19(2)11-10-12-20(3)22-13-16-30(9)29(22,8)18-25(34)31-28(7)15-14-26(36-21(4)35)27(5,6)23(28)17-24(33)32(30,31)37-31/h19-20,22-26H,10-18H2,1-9H3 |
| InChIKey | IYZCDAVOZFPQJN-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.57 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|