C32H54O3 — CID 99575996
[(1S,2S,5S,7S,10R,11R,14R,15R)-2,6,6,11,15-pentamethyl-14-[(2S)-6-methylheptan-2-yl]-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-yl] acetate (PubChem CID 99575996) has the molecular formula C32H54O3 and a molecular weight of 486.78 g/mol. Its IUPAC name is [(1S,2S,5S,7S,10R,11R,14R,15R)-2,6,6,11,15-pentamethyl-14-[(2S)-6-methylheptan-2-yl]-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-yl] acetate.
| Compound Name | [(1S,2S,5S,7S,10R,11R,14R,15R)-2,6,6,11,15-pentamethyl-14-[(2S)-6-methylheptan-2-yl]-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 99575996 |
| Molecular Formula | C32H54O3 |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.41 |
| IUPAC Name | [(1S,2S,5S,7S,10R,11R,14R,15R)-2,6,6,11,15-pentamethyl-14-[(2S)-6-methylheptan-2-yl]-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]34O[C@]32CC[C@]2(C)[C@@H]([C@@H](C)CCCC(C)C)CC[C@@]42C)C1(C)C |
| InChI | InChI=1S/C32H54O3/c1-21(2)11-10-12-22(3)24-13-17-30(9)28(24,7)19-20-31-29(8)16-15-26(34-23(4)33)27(5,6)25(29)14-18-32(30,31)35-31/h21-22,24-26H,10-20H2,1-9H3/t22-,24+,25-,26-,28+,29-,30+,31-,32+/m0/s1 |
| InChIKey | OTZBAICASWHSOB-CHQCIBLBSA-N |
| XLogP | 8.34 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|