C29H48O2 — CID 4281168
2,6,11,15-tetramethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-one (PubChem CID 4281168) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is 2,6,11,15-tetramethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-one.
| Compound Name | 2,6,11,15-tetramethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-one |
|---|---|
| PubChem CID | 4281168 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | 2,6,11,15-tetramethyl-14-(6-methylheptan-2-yl)-18-oxapentacyclo[8.7.1.01,10.02,7.011,15]octadecan-5-one |
| SMILES | CC(C)CCCC(C)C1CCC2(C)C1(C)CCC13OC21CCC1C(C)C(=O)CCC13C |
| InChI | InChI=1S/C29H48O2/c1-19(2)9-8-10-20(3)22-11-15-27(7)25(22,5)17-18-28-26(6)14-13-24(30)21(4)23(26)12-16-29(27,28)31-28/h19-23H,8-18H2,1-7H3 |
| InChIKey | QXRLFOIWIZFYOW-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|