C33H56O5 — CID 169089009
[2-[(2R,5R,6R,11S)-5-[(2R)-6-acetyloxyoctan-2-yl]-2,6,10,10-tetramethyl-14-oxatetracyclo[7.4.1.01,9.02,6]tetradecan-11-yl]-2-methylpropyl] acetate (PubChem CID 169089009) has the molecular formula C33H56O5 and a molecular weight of 532.81 g/mol. Its IUPAC name is [2-[(2R,5R,6R,11S)-5-[(2R)-6-acetyloxyoctan-2-yl]-2,6,10,10-tetramethyl-14-oxatetracyclo[7.4.1.01,9.02,6]tetradecan-11-yl]-2-methylpropyl] acetate.
| Compound Name | [2-[(2R,5R,6R,11S)-5-[(2R)-6-acetyloxyoctan-2-yl]-2,6,10,10-tetramethyl-14-oxatetracyclo[7.4.1.01,9.02,6]tetradecan-11-yl]-2-methylpropyl] acetate |
|---|---|
| PubChem CID | 169089009 |
| Molecular Formula | C33H56O5 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.41 |
| IUPAC Name | [2-[(2R,5R,6R,11S)-5-[(2R)-6-acetyloxyoctan-2-yl]-2,6,10,10-tetramethyl-14-oxatetracyclo[7.4.1.01,9.02,6]tetradecan-11-yl]-2-methylpropyl] acetate |
| SMILES | CCC(CCC[C@@H](C)[C@H]1CC[C@@]2(C)C34CC[C@@H](C(C)(C)COC(C)=O)C(C)(C)C3(CC[C@]12C)O4)OC(C)=O |
| InChI | InChI=1S/C33H56O5/c1-11-25(37-24(4)35)14-12-13-22(2)26-15-17-31(10)30(26,9)19-20-32-29(7,8)27(16-18-33(31,32)38-32)28(5,6)21-36-23(3)34/h22,25-27H,11-21H2,1-10H3/t22-,25?,26-,27+,30-,31-,32?,33?/m1/s1 |
| InChIKey | MMGGTNMNLSUNFG-BWXZTVQGSA-N |
| XLogP | 7.88 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|