C30H52 — CID 143705242
(8S,9R,10S,13R,14R)-8,9,10,13,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 143705242) has the molecular formula C30H52 and a molecular weight of 412.75 g/mol. Its IUPAC name is (8S,9R,10S,13R,14R)-8,9,10,13,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,13R,14R)-8,9,10,13,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 143705242 |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | (8S,9R,10S,13R,14R)-8,9,10,13,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CC(C)CCC[C@@H](C)C1CC[C@@]2(C)[C@]3(C)CC=C4CCCC[C@]4(C)[C@@]3(C)CC[C@]12C |
| InChI | InChI=1S/C30H52/c1-22(2)12-11-13-23(3)25-16-19-28(6)27(25,5)20-21-29(7)26(4)17-10-9-14-24(26)15-18-30(28,29)8/h15,22-23,25H,9-14,16-21H2,1-8H3/t23-,25?,26+,27-,28-,29-,30+/m1/s1 |
| InChIKey | POBKKEVYOHWFGI-SBLMCFEJSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|