C31H54O — CID 163047664
3,4,4,10,13,14-hexamethyl-17-(6-methylheptan-2-yl)-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 163047664) has the molecular formula C31H54O and a molecular weight of 442.77 g/mol. Its IUPAC name is 3,4,4,10,13,14-hexamethyl-17-(6-methylheptan-2-yl)-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | 3,4,4,10,13,14-hexamethyl-17-(6-methylheptan-2-yl)-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 163047664 |
| Molecular Formula | C31H54O |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.42 |
| IUPAC Name | 3,4,4,10,13,14-hexamethyl-17-(6-methylheptan-2-yl)-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCCC(C)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(C)(O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C31H54O/c1-21(2)11-10-12-22(3)23-15-17-30(8)25-13-14-26-27(4,5)31(9,32)20-19-28(26,6)24(25)16-18-29(23,30)7/h21-23,26,32H,10-20H2,1-9H3 |
| InChIKey | QBSJHOGDIUQWTH-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|