C31H49NO — CID 101252498
(2S,10R,14R,17R,18R)-2,9,9,14,18-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-6-oxa-7-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-1(13),4,7-triene (PubChem CID 101252498) has the molecular formula C31H49NO and a molecular weight of 451.74 g/mol. Its IUPAC name is (2S,10R,14R,17R,18R)-2,9,9,14,18-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-6-oxa-7-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-1(13),4,7-triene.
| Compound Name | (2S,10R,14R,17R,18R)-2,9,9,14,18-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-6-oxa-7-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-1(13),4,7-triene |
|---|---|
| PubChem CID | 101252498 |
| Molecular Formula | C31H49NO |
| Molecular Weight | 451.74 g/mol |
| Exact Mass | 451.38 |
| IUPAC Name | (2S,10R,14R,17R,18R)-2,9,9,14,18-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-6-oxa-7-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-1(13),4,7-triene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)Cc2conc2C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C31H49NO/c1-20(2)10-9-11-21(3)23-14-16-31(8)25-12-13-26-28(4,5)27-22(19-33-32-27)18-29(26,6)24(25)15-17-30(23,31)7/h19-21,23,26H,9-18H2,1-8H3/t21-,23-,26+,29-,30-,31+/m1/s1 |
| InChIKey | MWVSGQMJHJBKDB-YRVWSMEOSA-N |
| XLogP | 8.90 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.74 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|