C30H50O2 — CID 131857513
(5'S,10'S,13'R,17'R)-10',13',14'-trimethyl-17'-[(2R)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,3'-2,4,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene] (PubChem CID 131857513) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is (5'S,10'S,13'R,17'R)-10',13',14'-trimethyl-17'-[(2R)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,3'-2,4,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene].
| Compound Name | (5'S,10'S,13'R,17'R)-10',13',14'-trimethyl-17'-[(2R)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,3'-2,4,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene] |
|---|---|
| PubChem CID | 131857513 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | (5'S,10'S,13'R,17'R)-10',13',14'-trimethyl-17'-[(2R)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,3'-2,4,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene] |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC2(C[C@@H]1CC3)OCCO2 |
| InChI | InChI=1S/C30H50O2/c1-21(2)8-7-9-22(3)24-12-14-29(6)26-11-10-23-20-30(31-18-19-32-30)17-16-27(23,4)25(26)13-15-28(24,29)5/h21-24H,7-20H2,1-6H3/t22-,23+,24-,27+,28-,29?/m1/s1 |
| InChIKey | SENSKDWIOSPJMI-PUPXYFAXSA-N |
| XLogP | 8.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|