C31H50O3 — CID 124916563
methyl (4S,5S,10S,13R,14R,17S)-3-hydroxy-4,10,13,14-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,4,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylate (PubChem CID 124916563) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is methyl (4S,5S,10S,13R,14R,17S)-3-hydroxy-4,10,13,14-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,4,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylate.
| Compound Name | methyl (4S,5S,10S,13R,14R,17S)-3-hydroxy-4,10,13,14-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,4,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 124916563 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | methyl (4S,5S,10S,13R,14R,17S)-3-hydroxy-4,10,13,14-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,4,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylate |
| SMILES | COC(=O)C1=C(O)[C@@H](C)[C@@H]2CCC3=C(CC[C@]4(C)[C@H]([C@H](C)CCCC(C)C)CC[C@@]34C)[C@@]2(C)C1 |
| InChI | InChI=1S/C31H50O3/c1-19(2)10-9-11-20(3)23-14-16-31(7)26-13-12-24-21(4)27(32)22(28(33)34-8)18-29(24,5)25(26)15-17-30(23,31)6/h19-21,23-24,32H,9-18H2,1-8H3/t20-,21+,23+,24+,29+,30-,31+/m1/s1 |
| InChIKey | NQSZYDLBIXCGJZ-QCLMTRGTSA-N |
| XLogP | 8.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|