C27H44O — CID 2752864
(10S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.02,7.03,7.011,15]heptadecan-4-one (PubChem CID 2752864) has the molecular formula C27H44O and a molecular weight of 384.65 g/mol. Its IUPAC name is (10S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.02,7.03,7.011,15]heptadecan-4-one.
| Compound Name | (10S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.02,7.03,7.011,15]heptadecan-4-one |
|---|---|
| PubChem CID | 2752864 |
| Molecular Formula | C27H44O |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.34 |
| IUPAC Name | (10S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]pentacyclo[8.7.0.02,7.03,7.011,15]heptadecan-4-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2[C@@H]3CCC45CCC(=O)C4C5(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H44O/c1-17(2)7-6-8-18(3)20-9-10-21-19-11-15-27-16-13-23(28)24(27)26(27,5)22(19)12-14-25(20,21)4/h17-22,24H,6-16H2,1-5H3/t18-,19+,20-,21?,22?,24?,25-,26?,27?/m1/s1 |
| InChIKey | HZLDSDAIGDUPNB-JAXQNTEJSA-N |
| XLogP | 7.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |