C28H48O — CID 580421
10a-ethyl-3a,5a-dimethyl-6-(6-methylheptan-2-yl)-2,3,3b,4,5,6,7,8,8a,8b,9,10-dodecahydroindeno[5,4-e]inden-1-one (PubChem CID 580421) has the molecular formula C28H48O and a molecular weight of 400.69 g/mol. Its IUPAC name is 10a-ethyl-3a,5a-dimethyl-6-(6-methylheptan-2-yl)-2,3,3b,4,5,6,7,8,8a,8b,9,10-dodecahydroindeno[5,4-e]inden-1-one.
| Compound Name | 10a-ethyl-3a,5a-dimethyl-6-(6-methylheptan-2-yl)-2,3,3b,4,5,6,7,8,8a,8b,9,10-dodecahydroindeno[5,4-e]inden-1-one |
|---|---|
| PubChem CID | 580421 |
| Molecular Formula | C28H48O |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | 10a-ethyl-3a,5a-dimethyl-6-(6-methylheptan-2-yl)-2,3,3b,4,5,6,7,8,8a,8b,9,10-dodecahydroindeno[5,4-e]inden-1-one |
| SMILES | CCC12CCC3C4CCC(C(C)CCCC(C)C)C4(C)CCC3C1(C)CCC2=O |
| InChI | InChI=1S/C28H48O/c1-7-28-18-13-21-23-12-11-22(20(4)10-8-9-19(2)3)26(23,5)16-14-24(21)27(28,6)17-15-25(28)29/h19-24H,7-18H2,1-6H3 |
| InChIKey | KUPZFHLHCMPDRF-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |