C33H52O2 — CID 91750702
[(1S,3S,6S,12R,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methyl-5-methylideneheptan-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-10-enyl] acetate (PubChem CID 91750702) has the molecular formula C33H52O2 and a molecular weight of 480.78 g/mol. Its IUPAC name is [(1S,3S,6S,12R,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methyl-5-methylideneheptan-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-10-enyl] acetate.
| Compound Name | [(1S,3S,6S,12R,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methyl-5-methylideneheptan-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-10-enyl] acetate |
|---|---|
| PubChem CID | 91750702 |
| Molecular Formula | C33H52O2 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.40 |
| IUPAC Name | [(1S,3S,6S,12R,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methyl-5-methylideneheptan-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-10-enyl] acetate |
| SMILES | C=C(CC[C@@H](C)[C@H]1CC[C@@]2(C)C3=CCC4C(C)(C)[C@@H](OC(C)=O)CC[C@]45C[C@]35CC[C@]12C)C(C)C |
| InChI | InChI=1S/C33H52O2/c1-21(2)22(3)10-11-23(4)25-14-16-31(9)27-13-12-26-29(6,7)28(35-24(5)34)15-17-32(26)20-33(27,32)19-18-30(25,31)8/h13,21,23,25-26,28H,3,10-12,14-20H2,1-2,4-9H3/t23-,25-,26?,28+,30-,31+,32+,33-/m1/s1 |
| InChIKey | NSVYRGOREINNBF-SAPYBHQUSA-N |
| XLogP | 8.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|