C30H48O — CID 14137684
7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadec-10-en-6-ol (PubChem CID 14137684) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is 7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadec-10-en-6-ol.
| Compound Name | 7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadec-10-en-6-ol |
|---|---|
| PubChem CID | 14137684 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | 7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)pentacyclo[9.7.0.01,3.03,8.012,16]octadec-10-en-6-ol |
| SMILES | CC(C)=CCCC(C)C1CCC2(C)C3=CCC4C(C)(C)C(O)CCC45CC35CCC12C |
| InChI | InChI=1S/C30H48O/c1-20(2)9-8-10-21(3)22-13-15-28(7)24-12-11-23-26(4,5)25(31)14-16-29(23)19-30(24,29)18-17-27(22,28)6/h9,12,21-23,25,31H,8,10-11,13-19H2,1-7H3 |
| InChIKey | PHXROWPRWPUNFG-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|