C33H56O2 — CID 57375374
[(8S,9S,10R,13R,14S,17R)-4,4-diethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 57375374) has the molecular formula C33H56O2 and a molecular weight of 484.81 g/mol. Its IUPAC name is [(8S,9S,10R,13R,14S,17R)-4,4-diethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,9S,10R,13R,14S,17R)-4,4-diethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 57375374 |
| Molecular Formula | C33H56O2 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.43 |
| IUPAC Name | [(8S,9S,10R,13R,14S,17R)-4,4-diethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCC1(CC)C2=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]3[C@@]2(C)CCC1OC(C)=O |
| InChI | InChI=1S/C33H56O2/c1-9-33(10-2)29-17-14-25-27-16-15-26(23(5)13-11-12-22(3)4)31(27,7)20-18-28(25)32(29,8)21-19-30(33)35-24(6)34/h17,22-23,25-28,30H,9-16,18-21H2,1-8H3/t23-,25+,26-,27+,28+,30?,31-,32-/m1/s1 |
| InChIKey | QLRYFCBBKNTSOH-OSYGIMJVSA-N |
| XLogP | 9.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|