C36H56N2O2 — CID 58566970
[4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate (PubChem CID 58566970) has the molecular formula C36H56N2O2 and a molecular weight of 548.86 g/mol. Its IUPAC name is [4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate.
| Compound Name | [4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 58566970 |
| Molecular Formula | C36H56N2O2 |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 548.43 |
| IUPAC Name | [4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4C(C)(C)C(OC(=O)c5cc(N)cc(N)c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C36H56N2O2/c1-22(2)9-8-10-23(3)28-12-13-29-27-11-14-31-34(4,5)32(40-33(39)24-19-25(37)21-26(38)20-24)16-18-36(31,7)30(27)15-17-35(28,29)6/h14,19-23,27-30,32H,8-13,15-18,37-38H2,1-7H3 |
| InChIKey | ZYEJLZAYERQFCR-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|