C34H52N2O3 — CID 174694092
[(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] 3,5-diaminobenzoate (PubChem CID 174694092) has the molecular formula C34H52N2O3 and a molecular weight of 536.80 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] 3,5-diaminobenzoate.
| Compound Name | [(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 174694092 |
| Molecular Formula | C34H52N2O3 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.40 |
| IUPAC Name | [(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] 3,5-diaminobenzoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC(OC(=O)c5cc(N)cc(N)c5)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H52N2O3/c1-20(2)7-6-8-21(3)28-11-12-29-27-10-9-23-17-26(37)19-31(34(23,5)30(27)13-14-33(28,29)4)39-32(38)22-15-24(35)18-25(36)16-22/h9,15-16,18,20-21,26-31,37H,6-8,10-14,17,19,35-36H2,1-5H3/t21-,26-,27+,28-,29+,30+,31?,33-,34+/m1/s1 |
| InChIKey | MFNCDLKUTKCIIU-XXRIATOWSA-N |
| XLogP | 7.39 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|