C30H50O4 — CID 176655250
2,3-dihydroxy-1-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]propan-1-one (PubChem CID 176655250) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is 2,3-dihydroxy-1-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]propan-1-one.
| Compound Name | 2,3-dihydroxy-1-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]propan-1-one |
|---|---|
| PubChem CID | 176655250 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | 2,3-dihydroxy-1-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]propan-1-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC(C(=O)C(O)CO)[C@@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H50O4/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-15-21(32)16-26(28(34)27(33)17-31)30(20,5)25(22)13-14-29(23,24)4/h9,18-19,21-27,31-33H,6-8,10-17H2,1-5H3/t19-,21-,22+,23-,24+,25+,26?,27?,29-,30-/m1/s1 |
| InChIKey | FELZUZAIWPDPMI-WHFUGUIOSA-N |
| XLogP | 5.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|