C27H45N2O+ — CID 174806274
(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1-diazonium (PubChem CID 174806274) has the molecular formula C27H45N2O+ and a molecular weight of 413.67 g/mol. Its IUPAC name is (3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1-diazonium.
| Compound Name | (3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1-diazonium |
|---|---|
| PubChem CID | 174806274 |
| Molecular Formula | C27H45N2O+ |
| Molecular Weight | 413.67 g/mol |
| Exact Mass | 413.35 |
| IUPAC Name | (3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1-diazonium |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC([N+]#N)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H45N2O/c1-17(2)7-6-8-18(3)22-11-12-23-21-10-9-19-15-20(30)16-25(29-28)27(19,5)24(21)13-14-26(22,23)4/h9,17-18,20-25,30H,6-8,10-16H2,1-5H3/q+1/t18-,20-,21+,22-,23+,24+,25?,26-,27+/m1/s1 |
| InChIKey | TUMFCXGCHBCYSH-BRAIFALHSA-N |
| XLogP | 7.22 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.67 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|