C28H47NO2 — CID 174945330
N-[(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]formamide (PubChem CID 174945330) has the molecular formula C28H47NO2 and a molecular weight of 429.69 g/mol. Its IUPAC name is N-[(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]formamide.
| Compound Name | N-[(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]formamide |
|---|---|
| PubChem CID | 174945330 |
| Molecular Formula | C28H47NO2 |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 429.36 |
| IUPAC Name | N-[(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]formamide |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC(NC=O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H47NO2/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-15-21(31)16-26(29-17-30)28(20,5)25(22)13-14-27(23,24)4/h9,17-19,21-26,31H,6-8,10-16H2,1-5H3,(H,29,30)/t19-,21-,22+,23-,24+,25+,26?,27-,28+/m1/s1 |
| InChIKey | XYUOONSNMOGLBN-KIRGPPRJSA-N |
| XLogP | 6.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|