C31H57N3O — CID 174901996
(3R,8S,9S,10R,13R,14S,17R)-1-[2-(2-aminoethylamino)ethylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 174901996) has the molecular formula C31H57N3O and a molecular weight of 487.82 g/mol. Its IUPAC name is (3R,8S,9S,10R,13R,14S,17R)-1-[2-(2-aminoethylamino)ethylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,8S,9S,10R,13R,14S,17R)-1-[2-(2-aminoethylamino)ethylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 174901996 |
| Molecular Formula | C31H57N3O |
| Molecular Weight | 487.82 g/mol |
| Exact Mass | 487.45 |
| IUPAC Name | (3R,8S,9S,10R,13R,14S,17R)-1-[2-(2-aminoethylamino)ethylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC(NCCNCCN)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H57N3O/c1-21(2)7-6-8-22(3)26-11-12-27-25-10-9-23-19-24(35)20-29(34-18-17-33-16-15-32)31(23,5)28(25)13-14-30(26,27)4/h9,21-22,24-29,33-35H,6-8,10-20,32H2,1-5H3/t22-,24-,25+,26-,27+,28+,29?,30-,31+/m1/s1 |
| InChIKey | BAUJZMOYEHVWPS-GDCDRESWSA-N |
| XLogP | 5.51 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.82 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|