C33H52N2O2 — CID 141250392
(3S,8S,9S,10R,13R,14S,17R)-1-(2,4-diaminophenoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 141250392) has the molecular formula C33H52N2O2 and a molecular weight of 508.79 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-1-(2,4-diaminophenoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-1-(2,4-diaminophenoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 141250392 |
| Molecular Formula | C33H52N2O2 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.40 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-1-(2,4-diaminophenoxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](O)CC(Oc5ccc(N)cc5N)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H52N2O2/c1-20(2)7-6-8-21(3)26-12-13-27-25-11-9-22-17-24(36)19-31(37-30-14-10-23(34)18-29(30)35)33(22,5)28(25)15-16-32(26,27)4/h9-10,14,18,20-21,24-28,31,36H,6-8,11-13,15-17,19,34-35H2,1-5H3/t21-,24+,25+,26-,27+,28+,31?,32-,33+/m1/s1 |
| InChIKey | OOHUFKOFYQAKAV-PDIVCKDFSA-N |
| XLogP | 7.61 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|