C38H60N2 — CID 144549527
5-[3-[4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]prop-1-en-2-yl]benzene-1,3-diamine (PubChem CID 144549527) has the molecular formula C38H60N2 and a molecular weight of 544.91 g/mol. Its IUPAC name is 5-[3-[4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]prop-1-en-2-yl]benzene-1,3-diamine.
| Compound Name | 5-[3-[4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]prop-1-en-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 144549527 |
| Molecular Formula | C38H60N2 |
| Molecular Weight | 544.91 g/mol |
| Exact Mass | 544.48 |
| IUPAC Name | 5-[3-[4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]prop-1-en-2-yl]benzene-1,3-diamine |
| SMILES | C=C(CC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1(C)C)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C38H60N2/c1-24(2)10-9-11-25(3)32-13-14-33-31-12-15-35-36(5,6)28(20-26(4)27-21-29(39)23-30(40)22-27)16-18-38(35,8)34(31)17-19-37(32,33)7/h15,21-25,28,31-34H,4,9-14,16-20,39-40H2,1-3,5-8H3 |
| InChIKey | WUEIUEHLKJVGKC-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.91 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|