C36H56N2 — CID 143856110
5-[[4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]methyl]benzene-1,3-diamine (PubChem CID 143856110) has the molecular formula C36H56N2 and a molecular weight of 516.86 g/mol. Its IUPAC name is 5-[[4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]methyl]benzene-1,3-diamine.
| Compound Name | 5-[[4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]methyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 143856110 |
| Molecular Formula | C36H56N2 |
| Molecular Weight | 516.86 g/mol |
| Exact Mass | 516.44 |
| IUPAC Name | 5-[[4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]methyl]benzene-1,3-diamine |
| SMILES | CC(C)=CCCC(C)C1CCC2C3CC=C4C(C)(C)C(Cc5cc(N)cc(N)c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C36H56N2/c1-23(2)9-8-10-24(3)30-12-13-31-29-11-14-33-34(4,5)26(19-25-20-27(37)22-28(38)21-25)15-17-36(33,7)32(29)16-18-35(30,31)6/h9,14,20-22,24,26,29-32H,8,10-13,15-19,37-38H2,1-7H3 |
| InChIKey | RFPYGLCQPYYFHL-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.86 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|