C35H52N2 — CID 144691228
4-[2,7,16-trimethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]benzene-1,3-diamine (PubChem CID 144691228) has the molecular formula C35H52N2 and a molecular weight of 500.82 g/mol. Its IUPAC name is 4-[2,7,16-trimethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]benzene-1,3-diamine.
| Compound Name | 4-[2,7,16-trimethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 144691228 |
| Molecular Formula | C35H52N2 |
| Molecular Weight | 500.82 g/mol |
| Exact Mass | 500.41 |
| IUPAC Name | 4-[2,7,16-trimethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]benzene-1,3-diamine |
| SMILES | CC(C)=CCCC(C)C1CCC2C3CC=C4C(C)(CCC5C(c6ccc(N)cc6N)C45C)C3CCC12C |
| InChI | InChI=1S/C35H52N2/c1-21(2)8-7-9-22(3)26-13-14-27-24-12-15-31-34(5,28(24)16-18-33(26,27)4)19-17-29-32(35(29,31)6)25-11-10-23(36)20-30(25)37/h8,10-11,15,20,22,24,26-29,32H,7,9,12-14,16-19,36-37H2,1-6H3 |
| InChIKey | XPZKRUVRAMLYJQ-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.82 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|