C35H56N2O — CID 58069123
2-[[4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]benzene-1,4-diamine (PubChem CID 58069123) has the molecular formula C35H56N2O and a molecular weight of 520.85 g/mol. Its IUPAC name is 2-[[4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]benzene-1,4-diamine.
| Compound Name | 2-[[4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]benzene-1,4-diamine |
|---|---|
| PubChem CID | 58069123 |
| Molecular Formula | C35H56N2O |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.44 |
| IUPAC Name | 2-[[4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]benzene-1,4-diamine |
| SMILES | CC(C)=CCCC(C)C1CCC2C3CCC4C(C)(C)C(Oc5cc(N)ccc5N)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C35H56N2O/c1-22(2)9-8-10-23(3)26-13-14-27-25-12-16-31-33(4,5)32(38-30-21-24(36)11-15-29(30)37)18-20-35(31,7)28(25)17-19-34(26,27)6/h9,11,15,21,23,25-28,31-32H,8,10,12-14,16-20,36-37H2,1-7H3 |
| InChIKey | NPXCTHSCYZUMOT-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|