C37H58N2O2 — CID 58050884
[4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] 3,5-diaminobenzoate (PubChem CID 58050884) has the molecular formula C37H58N2O2 and a molecular weight of 562.88 g/mol. Its IUPAC name is [4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] 3,5-diaminobenzoate.
| Compound Name | [4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 58050884 |
| Molecular Formula | C37H58N2O2 |
| Molecular Weight | 562.88 g/mol |
| Exact Mass | 562.45 |
| IUPAC Name | [4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] 3,5-diaminobenzoate |
| SMILES | CC(C)=CCCCC(C)C1CCC2C3CCC4C(C)(C)CC(OC(=O)c5cc(N)cc(N)c5)CC4(C)C3CCC12C |
| InChI | InChI=1S/C37H58N2O2/c1-23(2)10-8-9-11-24(3)30-13-14-31-29-12-15-33-35(4,5)21-28(22-37(33,7)32(29)16-17-36(30,31)6)41-34(40)25-18-26(38)20-27(39)19-25/h10,18-20,24,28-33H,8-9,11-17,21-22,38-39H2,1-7H3 |
| InChIKey | IWOQJQXTCQRMQV-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.88 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|