C37H57NO2Si — CID 137329150
[4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-amino-5-silylbenzoate (PubChem CID 137329150) has the molecular formula C37H57NO2Si and a molecular weight of 575.95 g/mol. Its IUPAC name is [4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-amino-5-silylbenzoate.
| Compound Name | [4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-amino-5-silylbenzoate |
|---|---|
| PubChem CID | 137329150 |
| Molecular Formula | C37H57NO2Si |
| Molecular Weight | 575.95 g/mol |
| Exact Mass | 575.42 |
| IUPAC Name | [4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-amino-5-silylbenzoate |
| SMILES | CC(C)=CCCCC(C)C1CCC2C3CC=C4C(C)(C)C(OC(=O)c5cc(N)cc([SiH3])c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C37H57NO2Si/c1-23(2)10-8-9-11-24(3)29-13-14-30-28-12-15-32-35(4,5)33(40-34(39)25-20-26(38)22-27(41)21-25)17-19-37(32,7)31(28)16-18-36(29,30)6/h10,15,20-22,24,28-31,33H,8-9,11-14,16-19,38H2,1-7,41H3 |
| InChIKey | NNHFMCGBVOSQQU-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.95 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|