C41H70N2O2 — CID 144809450
3,5-diaminophenol;pentane;4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 144809450) has the molecular formula C41H70N2O2 and a molecular weight of 623.02 g/mol. Its IUPAC name is 3,5-diaminophenol;pentane;4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | 3,5-diaminophenol;pentane;4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 144809450 |
| Molecular Formula | C41H70N2O2 |
| Molecular Weight | 623.02 g/mol |
| Exact Mass | 622.54 |
| IUPAC Name | 3,5-diaminophenol;pentane;4,4,10,13-tetramethyl-17-(7-methyloct-6-en-2-yl)-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)=CCCCC(C)C1CCC2C3CC=C4C(C)(C)C(O)CCC4(C)C3CCC12C.CCCCC.Nc1cc(N)cc(O)c1 |
| InChI | InChI=1S/C30H50O.C6H8N2O.C5H12/c1-20(2)10-8-9-11-21(3)23-13-14-24-22-12-15-26-28(4,5)27(31)17-19-30(26,7)25(22)16-18-29(23,24)6;7-4-1-5(8)3-6(9)2-4;1-3-5-4-2/h10,15,21-25,27,31H,8-9,11-14,16-19H2,1-7H3;1-3,9H,7-8H2;3-5H2,1-2H3 |
| InChIKey | NANGSGRDDFJSRJ-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.02 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|