C43H65N5O3 — CID 144635754
1-(3,5-diaminophenyl)ethanone;[10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate;methanamine (PubChem CID 144635754) has the molecular formula C43H65N5O3 and a molecular weight of 700.03 g/mol. Its IUPAC name is 1-(3,5-diaminophenyl)ethanone;[10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate;methanamine.
| Compound Name | 1-(3,5-diaminophenyl)ethanone;[10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate;methanamine |
|---|---|
| PubChem CID | 144635754 |
| Molecular Formula | C43H65N5O3 |
| Molecular Weight | 700.03 g/mol |
| Exact Mass | 699.51 |
| IUPAC Name | 1-(3,5-diaminophenyl)ethanone;[10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-diaminobenzoate;methanamine |
| SMILES | CC(=O)c1cc(N)cc(N)c1.CC(C)=CCCC(C)C1CCC2C3C=CC4CC(OC(=O)c5cc(N)cc(N)c5)CCC4(C)C3CCC12C.CN |
| InChI | InChI=1S/C34H50N2O2.C8H10N2O.CH5N/c1-21(2)7-6-8-22(3)29-11-12-30-28-10-9-24-19-27(38-32(37)23-17-25(35)20-26(36)18-23)13-15-33(24,4)31(28)14-16-34(29,30)5;1-5(11)6-2-7(9)4-8(10)3-6;1-2/h7,9-10,17-18,20,22,24,27-31H,6,8,11-16,19,35-36H2,1-5H3;2-4H,9-10H2,1H3;2H2,1H3 |
| InChIKey | BRUZJCRTLUUTQV-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 173.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.03 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|