C34H57NO3 — CID 129066023
[(8R,9R,10R,13S,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (1-methylpiperidin-4-yl) carbonate (PubChem CID 129066023) has the molecular formula C34H57NO3 and a molecular weight of 527.83 g/mol. Its IUPAC name is [(8R,9R,10R,13S,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (1-methylpiperidin-4-yl) carbonate.
| Compound Name | [(8R,9R,10R,13S,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (1-methylpiperidin-4-yl) carbonate |
|---|---|
| PubChem CID | 129066023 |
| Molecular Formula | C34H57NO3 |
| Molecular Weight | 527.83 g/mol |
| Exact Mass | 527.43 |
| IUPAC Name | [(8R,9R,10R,13S,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (1-methylpiperidin-4-yl) carbonate |
| SMILES | CC(C)CCC[C@H](C)[C@@H]1CC[C@@H]2[C@H]3C=CC4CC(OC(=O)OC5CCN(C)CC5)CC[C@@]4(C)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C34H57NO3/c1-23(2)8-7-9-24(3)29-12-13-30-28-11-10-25-22-27(38-32(36)37-26-16-20-35(6)21-17-26)14-18-33(25,4)31(28)15-19-34(29,30)5/h10-11,23-31H,7-9,12-22H2,1-6H3/t24-,25?,27?,28+,29-,30+,31+,33+,34-/m0/s1 |
| InChIKey | HPGDMLPPLAHLLR-YERIZETJSA-N |
| XLogP | 8.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.83 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|