C41H70N4O — CID 145148493
4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]benzene-1,3-diamine;ethane;(3E)-hexa-3,5-diene-2,4-diamine (PubChem CID 145148493) has the molecular formula C41H70N4O and a molecular weight of 635.04 g/mol. Its IUPAC name is 4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]benzene-1,3-diamine;ethane;(3E)-hexa-3,5-diene-2,4-diamine.
| Compound Name | 4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]benzene-1,3-diamine;ethane;(3E)-hexa-3,5-diene-2,4-diamine |
|---|---|
| PubChem CID | 145148493 |
| Molecular Formula | C41H70N4O |
| Molecular Weight | 635.04 g/mol |
| Exact Mass | 634.55 |
| IUPAC Name | 4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]benzene-1,3-diamine;ethane;(3E)-hexa-3,5-diene-2,4-diamine |
| SMILES | C=C/C(N)=C\C(C)N.CC.CC(C)CCCC(C)C1CCC2C3C=CC4CC(Oc5ccc(N)cc5N)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C33H52N2O.C6H12N2.C2H6/c1-21(2)7-6-8-22(3)27-12-13-28-26-11-9-23-19-25(36-31-14-10-24(34)20-30(31)35)15-17-32(23,4)29(26)16-18-33(27,28)5;1-3-6(8)4-5(2)7;1-2/h9-11,14,20-23,25-29H,6-8,12-13,15-19,34-35H2,1-5H3;3-5H,1,7-8H2,2H3;1-2H3/b;6-4+; |
| InChIKey | LSXQLKGANKPHMP-HWWUXOKASA-N |
| XLogP | 9.88 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.04 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|