C34H54N2O — CID 142396916
4-[[(18R)-2,5-dimethyl-6-(6-methylheptan-2-yl)-15-pentacyclo[8.7.1.01,13.03,18.05,9]octadecanyl]oxy]benzene-1,3-diamine (PubChem CID 142396916) has the molecular formula C34H54N2O and a molecular weight of 506.82 g/mol. Its IUPAC name is 4-[[(18R)-2,5-dimethyl-6-(6-methylheptan-2-yl)-15-pentacyclo[8.7.1.01,13.03,18.05,9]octadecanyl]oxy]benzene-1,3-diamine.
| Compound Name | 4-[[(18R)-2,5-dimethyl-6-(6-methylheptan-2-yl)-15-pentacyclo[8.7.1.01,13.03,18.05,9]octadecanyl]oxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 142396916 |
| Molecular Formula | C34H54N2O |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.42 |
| IUPAC Name | 4-[[(18R)-2,5-dimethyl-6-(6-methylheptan-2-yl)-15-pentacyclo[8.7.1.01,13.03,18.05,9]octadecanyl]oxy]benzene-1,3-diamine |
| SMILES | CC(C)CCCC(C)C1CCC2C3CCC4CC(Oc5ccc(N)cc5N)CCC45C(C)C(CC12C)[C@H]35 |
| InChI | InChI=1S/C34H54N2O/c1-20(2)7-6-8-21(3)28-12-13-29-26-11-9-23-17-25(37-31-14-10-24(35)18-30(31)36)15-16-34(23)22(4)27(32(26)34)19-33(28,29)5/h10,14,18,20-23,25-29,32H,6-9,11-13,15-17,19,35-36H2,1-5H3/t21?,22?,23?,25?,26?,27?,28?,29?,32-,33?,34?/m0/s1 |
| InChIKey | UXZDSXBZXGGOGI-ARYVEZTRSA-N |
| XLogP | 8.58 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|