C33H52N2O3 — CID 141065778
propyl (4R)-4-[(8R,9S,10S,13R,14S,17R)-3-(2,4-diaminophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 141065778) has the molecular formula C33H52N2O3 and a molecular weight of 524.79 g/mol. Its IUPAC name is propyl (4R)-4-[(8R,9S,10S,13R,14S,17R)-3-(2,4-diaminophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | propyl (4R)-4-[(8R,9S,10S,13R,14S,17R)-3-(2,4-diaminophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 141065778 |
| Molecular Formula | C33H52N2O3 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.40 |
| IUPAC Name | propyl (4R)-4-[(8R,9S,10S,13R,14S,17R)-3-(2,4-diaminophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CCCOC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CC(Oc5ccc(N)cc5N)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H52N2O3/c1-5-18-37-31(36)13-6-21(2)26-10-11-27-25-9-7-22-19-24(38-30-12-8-23(34)20-29(30)35)14-16-32(22,3)28(25)15-17-33(26,27)4/h8,12,20-22,24-28H,5-7,9-11,13-19,34-35H2,1-4H3/t21-,22?,24?,25+,26-,27+,28+,32+,33-/m1/s1 |
| InChIKey | BCWSBGCVNUILGB-DRHFEWTFSA-N |
| XLogP | 7.63 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|