C33H52N2O — CID 134243552
4-[[(17S)-10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]benzene-1,3-diamine (PubChem CID 134243552) has the molecular formula C33H52N2O and a molecular weight of 492.79 g/mol. Its IUPAC name is 4-[[(17S)-10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]benzene-1,3-diamine.
| Compound Name | 4-[[(17S)-10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 134243552 |
| Molecular Formula | C33H52N2O |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 492.41 |
| IUPAC Name | 4-[[(17S)-10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]benzene-1,3-diamine |
| SMILES | CC(C)=CCCC(C)[C@@H]1CCC2C3CCC4CC(Oc5ccc(N)cc5N)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C33H52N2O/c1-21(2)7-6-8-22(3)27-12-13-28-26-11-9-23-19-25(36-31-14-10-24(34)20-30(31)35)15-17-32(23,4)29(26)16-18-33(27,28)5/h7,10,14,20,22-23,25-29H,6,8-9,11-13,15-19,34-35H2,1-5H3/t22?,23?,25?,26?,27-,28?,29?,32?,33?/m0/s1 |
| InChIKey | LRZYNMOMAYJERG-VXNXRXMUSA-N |
| XLogP | 8.64 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|