C33H52N2O — CID 174999969
4-[6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-1-enoxy]benzene-1,3-diamine (PubChem CID 174999969) has the molecular formula C33H52N2O and a molecular weight of 492.79 g/mol. Its IUPAC name is 4-[6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-1-enoxy]benzene-1,3-diamine.
| Compound Name | 4-[6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-1-enoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 174999969 |
| Molecular Formula | C33H52N2O |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 492.41 |
| IUPAC Name | 4-[6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-1-enoxy]benzene-1,3-diamine |
| SMILES | CC(=COc1ccc(N)cc1N)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H52N2O/c1-22(21-36-31-16-12-25(34)20-30(31)35)8-7-9-23(2)27-14-15-28-26-13-11-24-10-5-6-18-32(24,3)29(26)17-19-33(27,28)4/h12,16,20-21,23-24,26-29H,5-11,13-15,17-19,34-35H2,1-4H3/t23?,24?,26-,27+,28-,29-,32-,33+/m0/s1 |
| InChIKey | SRSWWHUADMMSBA-CRUMTICCSA-N |
| XLogP | 8.99 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|