C34H54N2O3 — CID 175888373
3,5-diamino-2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptoxy]benzoic acid (PubChem CID 175888373) has the molecular formula C34H54N2O3 and a molecular weight of 538.82 g/mol. Its IUPAC name is 3,5-diamino-2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptoxy]benzoic acid.
| Compound Name | 3,5-diamino-2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptoxy]benzoic acid |
|---|---|
| PubChem CID | 175888373 |
| Molecular Formula | C34H54N2O3 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 538.41 |
| IUPAC Name | 3,5-diamino-2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptoxy]benzoic acid |
| SMILES | CC(CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C)COc1c(N)cc(N)cc1C(=O)O |
| InChI | InChI=1S/C34H54N2O3/c1-21(20-39-31-26(32(37)38)18-24(35)19-30(31)36)8-7-9-22(2)27-13-14-28-25-12-11-23-10-5-6-16-33(23,3)29(25)15-17-34(27,28)4/h18-19,21-23,25,27-29H,5-17,20,35-36H2,1-4H3,(H,37,38)/t21?,22-,23?,25+,27-,28+,29+,33+,34-/m1/s1 |
| InChIKey | HJMDKBBRSUIJBI-AOFKKLARSA-N |
| XLogP | 8.42 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|