C37H53NO3 — CID 141039227
3-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptoxy]-4-phenylpyrrole-2,5-dione (PubChem CID 141039227) has the molecular formula C37H53NO3 and a molecular weight of 559.84 g/mol. Its IUPAC name is 3-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptoxy]-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptoxy]-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 141039227 |
| Molecular Formula | C37H53NO3 |
| Molecular Weight | 559.84 g/mol |
| Exact Mass | 559.40 |
| IUPAC Name | 3-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptoxy]-4-phenylpyrrole-2,5-dione |
| SMILES | CC(CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C)COC1=C(c2ccccc2)C(=O)NC1=O |
| InChI | InChI=1S/C37H53NO3/c1-24(23-41-33-32(34(39)38-35(33)40)26-13-6-5-7-14-26)11-10-12-25(2)29-18-19-30-28-17-16-27-15-8-9-21-36(27,3)31(28)20-22-37(29,30)4/h5-7,13-14,24-25,27-31H,8-12,15-23H2,1-4H3,(H,38,39,40)/t24?,25-,27?,28+,29-,30+,31+,36+,37-/m1/s1 |
| InChIKey | FSLOVQHXWXNMLU-LSMWQVSYSA-N |
| XLogP | 8.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.84 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|